C17H20O9S — CID 158267591
2,3,4,5-tetramethyl-6-[(E)-3-oxo-3-(2-sulfoethoxy)prop-1-enoxy]carbonylbenzoic acid (PubChem CID 158267591) has the molecular formula C17H20O9S and a molecular weight of 400.41 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-6-[(E)-3-oxo-3-(2-sulfoethoxy)prop-1-enoxy]carbonylbenzoic acid.
| Compound Name | 2,3,4,5-tetramethyl-6-[(E)-3-oxo-3-(2-sulfoethoxy)prop-1-enoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 158267591 |
| Molecular Formula | C17H20O9S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2,3,4,5-tetramethyl-6-[(E)-3-oxo-3-(2-sulfoethoxy)prop-1-enoxy]carbonylbenzoic acid |
| SMILES | Cc1c(C)c(C)c(C(=O)O/C=C/C(=O)OCCS(=O)(=O)O)c(C(=O)O)c1C |
| InChI | InChI=1S/C17H20O9S/c1-9-10(2)12(4)15(14(11(9)3)16(19)20)17(21)26-6-5-13(18)25-7-8-27(22,23)24/h5-6H,7-8H2,1-4H3,(H,19,20)(H,22,23,24)/b6-5+ |
| InChIKey | LIXBCTMFFLGGPG-AATRIKPKSA-N |
| XLogP | 1.72 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|