C15H14F3N3O4 — CID 158271604
1-methyl-4-nitro-2-phenyl-5-(5,5,5-trifluoro-4-oxopentyl)pyrazol-3-one (PubChem CID 158271604) has the molecular formula C15H14F3N3O4 and a molecular weight of 357.29 g/mol. Its IUPAC name is 1-methyl-4-nitro-2-phenyl-5-(5,5,5-trifluoro-4-oxopentyl)pyrazol-3-one.
| Compound Name | 1-methyl-4-nitro-2-phenyl-5-(5,5,5-trifluoro-4-oxopentyl)pyrazol-3-one |
|---|---|
| PubChem CID | 158271604 |
| Molecular Formula | C15H14F3N3O4 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-methyl-4-nitro-2-phenyl-5-(5,5,5-trifluoro-4-oxopentyl)pyrazol-3-one |
| SMILES | Cn1c(CCCC(=O)C(F)(F)F)c([N+](=O)[O-])c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C15H14F3N3O4/c1-19-11(8-5-9-12(22)15(16,17)18)13(21(24)25)14(23)20(19)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | USGSDNQDMVFGTI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|