C31H47GdN3O12P-2 — CID 158277028
2-[[1-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]-3-[oxido(10-phenyldecoxy)phosphoryl]oxypropan-2-yl]-ethylamino]acetate;gadolinium(3+) (PubChem CID 158277028) has the molecular formula C31H47GdN3O12P-2 and a molecular weight of 841.95 g/mol. Its IUPAC name is 2-[[1-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]-3-[oxido(10-phenyldecoxy)phosphoryl]oxypropan-2-yl]-ethylamino]acetate;gadolinium(3+).
| Compound Name | 2-[[1-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]-3-[oxido(10-phenyldecoxy)phosphoryl]oxypropan-2-yl]-ethylamino]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 158277028 |
| Molecular Formula | C31H47GdN3O12P-2 |
| Molecular Weight | 841.95 g/mol |
| Exact Mass | 842.21 |
| IUPAC Name | 2-[[1-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]-3-[oxido(10-phenyldecoxy)phosphoryl]oxypropan-2-yl]-ethylamino]acetate;gadolinium(3+) |
| SMILES | CCN(CC(=O)[O-])C(COP(=O)([O-])OCCCCCCCCCCc1ccccc1)CN(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Gd+3] |
| InChI | InChI=1S/C31H52N3O12P.Gd/c1-2-34(24-31(41)42)27(20-32(21-28(35)36)17-18-33(22-29(37)38)23-30(39)40)25-46-47(43,44)45-19-13-8-6-4-3-5-7-10-14-26-15-11-9-12-16-26;/h9,11-12,15-16,27H,2-8,10,13-14,17-25H2,1H3,(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44);/q;+3/p-5 |
| InChIKey | GJSQRAHCSXZYSP-UHFFFAOYSA-I |
| XLogP | -2.85 |
| TPSA | 228.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.95 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|