C31H45N3O14P-5 — CID 58883745
2-[2-[bis(carboxylatomethyl)amino]ethyl-[2-[bis(carboxylatomethyl)amino]-3-[hydroxy-oxido-(10-phenyldecoxy)phosphaniumyl]oxypropyl]amino]acetate (PubChem CID 58883745) has the molecular formula C31H45N3O14P-5 and a molecular weight of 714.68 g/mol. Its IUPAC name is 2-[2-[bis(carboxylatomethyl)amino]ethyl-[2-[bis(carboxylatomethyl)amino]-3-[hydroxy-oxido-(10-phenyldecoxy)phosphaniumyl]oxypropyl]amino]acetate.
| Compound Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-[2-[bis(carboxylatomethyl)amino]-3-[hydroxy-oxido-(10-phenyldecoxy)phosphaniumyl]oxypropyl]amino]acetate |
|---|---|
| PubChem CID | 58883745 |
| Molecular Formula | C31H45N3O14P-5 |
| Molecular Weight | 714.68 g/mol |
| Exact Mass | 714.27 |
| IUPAC Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-[2-[bis(carboxylatomethyl)amino]-3-[hydroxy-oxido-(10-phenyldecoxy)phosphaniumyl]oxypropyl]amino]acetate |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(CO[P+]([O-])(O)OCCCCCCCCCCc1ccccc1)N(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C31H50N3O14P/c35-27(36)19-32(15-16-33(20-28(37)38)21-29(39)40)18-26(34(22-30(41)42)23-31(43)44)24-48-49(45,46)47-17-11-6-4-2-1-3-5-8-12-25-13-9-7-10-14-25/h7,9-10,13-14,26H,1-6,8,11-12,15-24H2,(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46)/p-5 |
| InChIKey | LCACDULMBCVZEK-UHFFFAOYSA-I |
| XLogP | -5.56 |
| TPSA | 272.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.68 |
| LogP ≤ 5 | -5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|