C31H51N3O14P+ — CID 71188942
[2-[bis(carboxymethyl)amino]-3-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]propoxy]-dihydroxy-(10-phenyldecoxy)phosphanium (PubChem CID 71188942) has the molecular formula C31H51N3O14P+ and a molecular weight of 720.73 g/mol. Its IUPAC name is [2-[bis(carboxymethyl)amino]-3-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]propoxy]-dihydroxy-(10-phenyldecoxy)phosphanium.
| Compound Name | [2-[bis(carboxymethyl)amino]-3-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]propoxy]-dihydroxy-(10-phenyldecoxy)phosphanium |
|---|---|
| PubChem CID | 71188942 |
| Molecular Formula | C31H51N3O14P+ |
| Molecular Weight | 720.73 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | [2-[bis(carboxymethyl)amino]-3-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]propoxy]-dihydroxy-(10-phenyldecoxy)phosphanium |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(CO[P+](O)(O)OCCCCCCCCCCc1ccccc1)N(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C31H50N3O14P/c35-27(36)19-32(15-16-33(20-28(37)38)21-29(39)40)18-26(34(22-30(41)42)23-31(43)44)24-48-49(45,46)47-17-11-6-4-2-1-3-5-8-12-25-13-9-7-10-14-25/h7,9-10,13-14,26,45-46H,1-6,8,11-12,15-24H2,(H4-,35,36,37,38,39,40,41,42,43,44)/p+1 |
| InChIKey | ZVIQUESUYIKLAX-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 255.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|