About diphenylphosphane;1H-imidazole
diphenylphosphane;1H-imidazole (PubChem CID 158285047) has the molecular formula C15H15N2P
and a molecular weight of 254.27 g/mol. Its IUPAC name is diphenylphosphane;1H-imidazole.
Molecular Properties
| Compound Name | diphenylphosphane;1H-imidazole |
| PubChem CID | 158285047 |
| Molecular Formula | C15H15N2P |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | diphenylphosphane;1H-imidazole |
| SMILES | c1c[nH]cn1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C3H4N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-5-3-4-1/h1-10,13H;1-3H,(H,4,5) |
| InChIKey | GKRGPUXTNPCXIP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;1H-imidazole?
The IUPAC name of diphenylphosphane;1H-imidazole (CID 158285047) is diphenylphosphane;1H-imidazole.
What is the SMILES notation for diphenylphosphane;1H-imidazole?
The canonical SMILES for diphenylphosphane;1H-imidazole is c1c[nH]cn1.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;1H-imidazole?
The InChIKey is GKRGPUXTNPCXIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.C3H4N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-5-3-4-1/h1-10,13H;1-3H,(H,4,5).
What are the key properties of diphenylphosphane;1H-imidazole?
diphenylphosphane;1H-imidazole has a molecular weight of 254.27 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;1H-imidazole is sourced from PubChem (CID 158285047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).