C11H6N4O2S2 — CID 15828724
13-oxo-13λ4,17-dithia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one (PubChem CID 15828724) has the molecular formula C11H6N4O2S2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 13-oxo-13λ4,17-dithia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one.
| Compound Name | 13-oxo-13λ4,17-dithia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one |
|---|---|
| PubChem CID | 15828724 |
| Molecular Formula | C11H6N4O2S2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 13-oxo-13λ4,17-dithia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one |
| SMILES | O=C1NS(=O)Nc2c1sc1nc3ccccc3nc21 |
| InChI | InChI=1S/C11H6N4O2S2/c16-10-9-7(14-19(17)15-10)8-11(18-9)13-6-4-2-1-3-5(6)12-8/h1-4,14H,(H,15,16) |
| InChIKey | IUHQXXGRVYJNNT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |