C11H4N4OS2 — CID 15828734
13lambda4,17-dithia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,13-octaen-15-one (PubChem CID 15828734) has the molecular formula C11H4N4OS2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 13lambda4,17-dithia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,13-octaen-15-one.
| Compound Name | 13lambda4,17-dithia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,13-octaen-15-one |
|---|---|
| PubChem CID | 15828734 |
| Molecular Formula | C11H4N4OS2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 13lambda4,17-dithia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,13-octaen-15-one |
| SMILES | O=C1N=S=Nc2c1sc1nc3ccccc3nc21 |
| InChI | InChI=1S/C11H4N4OS2/c16-10-9-7(14-18-15-10)8-11(17-9)13-6-4-2-1-3-5(6)12-8/h1-4H |
| InChIKey | FBKXZHHIKCTTLL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |