C7H9NO5 — CID 158288044
(Z)-3-hydroperoxy-4-(prop-2-enoylamino)but-3-enoic acid (PubChem CID 158288044) has the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. Its IUPAC name is (Z)-3-hydroperoxy-4-(prop-2-enoylamino)but-3-enoic acid.
| Compound Name | (Z)-3-hydroperoxy-4-(prop-2-enoylamino)but-3-enoic acid |
|---|---|
| PubChem CID | 158288044 |
| Molecular Formula | C7H9NO5 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | (Z)-3-hydroperoxy-4-(prop-2-enoylamino)but-3-enoic acid |
| SMILES | C=CC(=O)N/C=C(/CC(=O)O)OO |
| InChI | InChI=1S/C7H9NO5/c1-2-6(9)8-4-5(13-12)3-7(10)11/h2,4,12H,1,3H2,(H,8,9)(H,10,11)/b5-4- |
| InChIKey | VDPJWEVXAWXICD-PLNGDYQASA-N |
| XLogP | 0.09 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|