About N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate)
N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate) (PubChem CID 160745155) has the molecular formula C45H55NO17
and a molecular weight of 881.92 g/mol. Its IUPAC name is N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate).
Molecular Properties
| Compound Name | N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate) |
| PubChem CID | 160745155 |
| Molecular Formula | C45H55NO17 |
| Molecular Weight | 881.92 g/mol |
| Exact Mass | 881.35 |
| IUPAC Name | N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate) |
| SMILES | C=CNC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C |
| InChI | InChI=1S/C5H7NO.8C5H6O2/c1-3-5(7)6-4-2;8*1-3-5(6)7-4-2/h3-4H,1-2H2,(H,6,7);8*3-4H,1-2H2 |
| InChIKey | RWCICMWLDLRKSF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 239.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 881.92 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate)?
The IUPAC name of N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate) (CID 160745155) is N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate).
What is the SMILES notation for N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate)?
The canonical SMILES for N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate) is C=CNC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.C=COC(=O)C=C.
What is the InChIKey of N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate)?
The InChIKey is RWCICMWLDLRKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO.8C5H6O2/c1-3-5(7)6-4-2;8*1-3-5(6)7-4-2/h3-4H,1-2H2,(H,6,7);8*3-4H,1-2H2.
What are the key properties of N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate)?
N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate) has a molecular weight of 881.92 g/mol, XLogP of 7.30, 18 rotatable bonds, 1 hydrogen bond donors, and 17 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylprop-2-enamide;octakis(ethenyl prop-2-enoate) is sourced from PubChem (CID 160745155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).