About ethenyl 4-silylbut-2-enoate
ethenyl 4-silylbut-2-enoate (PubChem CID 174902560) has the molecular formula C6H10O2Si
and a molecular weight of 142.23 g/mol. Its IUPAC name is ethenyl 4-silylbut-2-enoate.
Molecular Properties
| Compound Name | ethenyl 4-silylbut-2-enoate |
| PubChem CID | 174902560 |
| Molecular Formula | C6H10O2Si |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | ethenyl 4-silylbut-2-enoate |
| SMILES | C=COC(=O)C=CC[SiH3] |
| InChI | InChI=1S/C6H10O2Si/c1-2-8-6(7)4-3-5-9/h2-4H,1,5H2,9H3 |
| InChIKey | FKZCRWOAJNMWEY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 4-silylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 4-silylbut-2-enoate?
The IUPAC name of ethenyl 4-silylbut-2-enoate (CID 174902560) is ethenyl 4-silylbut-2-enoate.
What is the SMILES notation for ethenyl 4-silylbut-2-enoate?
The canonical SMILES for ethenyl 4-silylbut-2-enoate is C=COC(=O)C=CC[SiH3].
What is the InChIKey of ethenyl 4-silylbut-2-enoate?
The InChIKey is FKZCRWOAJNMWEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2Si/c1-2-8-6(7)4-3-5-9/h2-4H,1,5H2,9H3.
What are the key properties of ethenyl 4-silylbut-2-enoate?
ethenyl 4-silylbut-2-enoate has a molecular weight of 142.23 g/mol, XLogP of 0.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 4-silylbut-2-enoate is sourced from PubChem (CID 174902560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).