C16H22O4 — CID 158288720
methane;2-methyl-3-[4-(3-oxopentanoyl)phenyl]propanoic acid (PubChem CID 158288720) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methane;2-methyl-3-[4-(3-oxopentanoyl)phenyl]propanoic acid.
| Compound Name | methane;2-methyl-3-[4-(3-oxopentanoyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 158288720 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | methane;2-methyl-3-[4-(3-oxopentanoyl)phenyl]propanoic acid |
| SMILES | C.CCC(=O)CC(=O)c1ccc(CC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C15H18O4.CH4/c1-3-13(16)9-14(17)12-6-4-11(5-7-12)8-10(2)15(18)19;/h4-7,10H,3,8-9H2,1-2H3,(H,18,19);1H4 |
| InChIKey | GLCCJOBZLMKYJC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|