C10H20FN3O2 — CID 158288818
CID 158288818 (PubChem CID 158288818) has the molecular formula C10H20FN3O2 and a molecular weight of 235.30 g/mol.
| Compound Name | CID 158288818 |
|---|---|
| PubChem CID | 158288818 |
| Molecular Formula | C10H20FN3O2 |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | — |
| SMILES | C.CC(C)N[C@@H](Cc1cnc[nH]1)C(=O)O.[3H]F |
| InChI | InChI=1S/C9H15N3O2.CH4.FH/c1-6(2)12-8(9(13)14)3-7-4-10-5-11-7;;/h4-6,8,12H,3H2,1-2H3,(H,10,11)(H,13,14);1H4;1H/t8-;;/m0../s1/i/hT |
| InChIKey | GLCMIJYJMJRMQL-BNKOMTAFSA-N |
| XLogP | 1.19 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |