C14H23N3O4 — CID 59101024
(2S)-2-[[(1R)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]octanoic acid (PubChem CID 59101024) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is (2S)-2-[[(1R)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]octanoic acid.
| Compound Name | (2S)-2-[[(1R)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]octanoic acid |
|---|---|
| PubChem CID | 59101024 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2S)-2-[[(1R)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]octanoic acid |
| SMILES | CCCCCC[C@H](N[C@H](Cc1cnc[nH]1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H23N3O4/c1-2-3-4-5-6-11(13(18)19)17-12(14(20)21)7-10-8-15-9-16-10/h8-9,11-12,17H,2-7H2,1H3,(H,15,16)(H,18,19)(H,20,21)/t11-,12+/m0/s1 |
| InChIKey | YQURQWFDIOJZQW-NWDGAFQWSA-N |
| XLogP | 1.42 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|