C24H44N4O3 — CID 90347165
(2S)-2-[[2-(dioctylamino)-2-oxoethyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 90347165) has the molecular formula C24H44N4O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is (2S)-2-[[2-(dioctylamino)-2-oxoethyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[[2-(dioctylamino)-2-oxoethyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 90347165 |
| Molecular Formula | C24H44N4O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | (2S)-2-[[2-(dioctylamino)-2-oxoethyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CN[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C24H44N4O3/c1-3-5-7-9-11-13-15-28(16-14-12-10-8-6-4-2)23(29)19-26-22(24(30)31)17-21-18-25-20-27-21/h18,20,22,26H,3-17,19H2,1-2H3,(H,25,27)(H,30,31)/t22-/m0/s1 |
| InChIKey | UEDVJMMPAVTAMA-QFIPXVFZSA-N |
| XLogP | 4.54 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|