C14H26N3O2P — CID 174568051
3-(1H-imidazol-5-yl)-2-(oct-1-en-3-ylamino)propanoic acid;phosphane (PubChem CID 174568051) has the molecular formula C14H26N3O2P and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-(oct-1-en-3-ylamino)propanoic acid;phosphane.
| Compound Name | 3-(1H-imidazol-5-yl)-2-(oct-1-en-3-ylamino)propanoic acid;phosphane |
|---|---|
| PubChem CID | 174568051 |
| Molecular Formula | C14H26N3O2P |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-(oct-1-en-3-ylamino)propanoic acid;phosphane |
| SMILES | C=CC(CCCCC)NC(Cc1cnc[nH]1)C(=O)O.P |
| InChI | InChI=1S/C14H23N3O2.H3P/c1-3-5-6-7-11(4-2)17-13(14(18)19)8-12-9-15-10-16-12;/h4,9-11,13,17H,2-3,5-8H2,1H3,(H,15,16)(H,18,19);1H3 |
| InChIKey | OSYYZTABKGTDEZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|