C16H18N2O4S — CID 158288860
2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide;methanesulfonic acid (PubChem CID 158288860) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide;methanesulfonic acid.
| Compound Name | 2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide;methanesulfonic acid |
|---|---|
| PubChem CID | 158288860 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[H]/N=C(\N)c1c(O)cccc1C=Cc1ccccc1 |
| InChI | InChI=1S/C15H14N2O.CH4O3S/c16-15(17)14-12(7-4-8-13(14)18)10-9-11-5-2-1-3-6-11;1-5(2,3)4/h1-10,18H,(H3,16,17);1H3,(H,2,3,4) |
| InChIKey | GLCPYQKGDVCOOI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|