About fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide
fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide (PubChem CID 160906620) has the molecular formula C15H14AuFN2O
and a molecular weight of 454.26 g/mol. Its IUPAC name is fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide |
| PubChem CID | 160906620 |
| Molecular Formula | C15H14AuFN2O |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide |
| SMILES | F[Au].[H]/N=C(\N)c1c(O)cccc1C=Cc1ccccc1 |
| InChI | InChI=1S/C15H14N2O.Au.FH/c16-15(17)14-12(7-4-8-13(14)18)10-9-11-5-2-1-3-6-11;;/h1-10,18H,(H3,16,17);;1H/q;+1;/p-1 |
| InChIKey | SQFOQVKMXZKEHA-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide?
The IUPAC name of fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide (CID 160906620) is fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide.
What is the SMILES notation for fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide?
The canonical SMILES for fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide is F[Au].[H]/N=C(\N)c1c(O)cccc1C=Cc1ccccc1.
What is the InChIKey of fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide?
The InChIKey is SQFOQVKMXZKEHA-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H14N2O.Au.FH/c16-15(17)14-12(7-4-8-13(14)18)10-9-11-5-2-1-3-6-11;;/h1-10,18H,(H3,16,17);;1H/q;+1;/p-1.
What are the key properties of fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide?
fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide has a molecular weight of 454.26 g/mol, XLogP of 3.26, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluorogold;2-hydroxy-6-(2-phenylethenyl)benzenecarboximidamide is sourced from PubChem (CID 160906620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).