C22H24N2O4 — CID 15829080
benzyl N-(2-oxoethyl)-N-[(E,4E)-4-phenylmethoxyiminopent-2-enyl]carbamate (PubChem CID 15829080) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is benzyl N-(2-oxoethyl)-N-[(E,4E)-4-phenylmethoxyiminopent-2-enyl]carbamate.
| Compound Name | benzyl N-(2-oxoethyl)-N-[(E,4E)-4-phenylmethoxyiminopent-2-enyl]carbamate |
|---|---|
| PubChem CID | 15829080 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | benzyl N-(2-oxoethyl)-N-[(E,4E)-4-phenylmethoxyiminopent-2-enyl]carbamate |
| SMILES | CC(/C=C/CN(CC=O)C(=O)OCc1ccccc1)=N\OCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O4/c1-19(23-28-18-21-12-6-3-7-13-21)9-8-14-24(15-16-25)22(26)27-17-20-10-4-2-5-11-20/h2-13,16H,14-15,17-18H2,1H3/b9-8+,23-19+ |
| InChIKey | LTWLYGBYHMQWKO-GLVIYYDGSA-N |
| XLogP | 3.97 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|