C17H30N2O4 — CID 158290896
(3R,4R,5S)-5-amino-3-[(3S)-3-(2-ethoxyethoxy)piperidin-1-yl]-4-methylcyclohexene-1-carboxylic acid (PubChem CID 158290896) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is (3R,4R,5S)-5-amino-3-[(3S)-3-(2-ethoxyethoxy)piperidin-1-yl]-4-methylcyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-5-amino-3-[(3S)-3-(2-ethoxyethoxy)piperidin-1-yl]-4-methylcyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 158290896 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (3R,4R,5S)-5-amino-3-[(3S)-3-(2-ethoxyethoxy)piperidin-1-yl]-4-methylcyclohexene-1-carboxylic acid |
| SMILES | CCOCCO[C@H]1CCCN([C@@H]2C=C(C(=O)O)C[C@H](N)[C@H]2C)C1 |
| InChI | InChI=1S/C17H30N2O4/c1-3-22-7-8-23-14-5-4-6-19(11-14)16-10-13(17(20)21)9-15(18)12(16)2/h10,12,14-16H,3-9,11,18H2,1-2H3,(H,20,21)/t12-,14+,15+,16-/m1/s1 |
| InChIKey | SVMDUYVFLNDNGC-SYAUCNOPSA-N |
| XLogP | 1.25 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|