C19H33N3O4 — CID 142300186
(4R,5S)-4-acetamido-5-amino-3-[(3S)-3-(butoxymethyl)piperidin-1-yl]cyclohexene-1-carboxylic acid (PubChem CID 142300186) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is (4R,5S)-4-acetamido-5-amino-3-[(3S)-3-(butoxymethyl)piperidin-1-yl]cyclohexene-1-carboxylic acid.
| Compound Name | (4R,5S)-4-acetamido-5-amino-3-[(3S)-3-(butoxymethyl)piperidin-1-yl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 142300186 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (4R,5S)-4-acetamido-5-amino-3-[(3S)-3-(butoxymethyl)piperidin-1-yl]cyclohexene-1-carboxylic acid |
| SMILES | CCCCOC[C@H]1CCCN(C2C=C(C(=O)O)C[C@H](N)[C@H]2NC(C)=O)C1 |
| InChI | InChI=1S/C19H33N3O4/c1-3-4-8-26-12-14-6-5-7-22(11-14)17-10-15(19(24)25)9-16(20)18(17)21-13(2)23/h10,14,16-18H,3-9,11-12,20H2,1-2H3,(H,21,23)(H,24,25)/t14-,16-,17?,18+/m0/s1 |
| InChIKey | REHGGMLIHXVIEZ-SWNQOZETSA-N |
| XLogP | 1.13 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|