C17H29N5O4 — CID 72720641
(3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3R)-3-ethoxypiperidin-1-yl]cyclohexene-1-carboxylic acid (PubChem CID 72720641) has the molecular formula C17H29N5O4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3R)-3-ethoxypiperidin-1-yl]cyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3R)-3-ethoxypiperidin-1-yl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 72720641 |
| Molecular Formula | C17H29N5O4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3R)-3-ethoxypiperidin-1-yl]cyclohexene-1-carboxylic acid |
| SMILES | CCO[C@@H]1CCCN([C@@H]2C=C(C(=O)O)C[C@H](N=C(N)N)[C@H]2NC(C)=O)C1 |
| InChI | InChI=1S/C17H29N5O4/c1-3-26-12-5-4-6-22(9-12)14-8-11(16(24)25)7-13(21-17(18)19)15(14)20-10(2)23/h8,12-15H,3-7,9H2,1-2H3,(H,20,23)(H,24,25)(H4,18,19,21)/t12-,13+,14-,15-/m1/s1 |
| InChIKey | FWDDBWNYCUDOQK-LXTVHRRPSA-N |
| XLogP | -0.58 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|