C19H34N6O5S — CID 72720848
(3R,4R,5S)-4-acetamido-3-[(3S)-3-(butylsulfonylamino)piperidin-1-yl]-5-(diaminomethylideneamino)cyclohexene-1-carboxylic acid (PubChem CID 72720848) has the molecular formula C19H34N6O5S and a molecular weight of 458.59 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-3-[(3S)-3-(butylsulfonylamino)piperidin-1-yl]-5-(diaminomethylideneamino)cyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-3-[(3S)-3-(butylsulfonylamino)piperidin-1-yl]-5-(diaminomethylideneamino)cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 72720848 |
| Molecular Formula | C19H34N6O5S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-3-[(3S)-3-(butylsulfonylamino)piperidin-1-yl]-5-(diaminomethylideneamino)cyclohexene-1-carboxylic acid |
| SMILES | CCCCS(=O)(=O)N[C@H]1CCCN([C@@H]2C=C(C(=O)O)C[C@H](N=C(N)N)[C@H]2NC(C)=O)C1 |
| InChI | InChI=1S/C19H34N6O5S/c1-3-4-8-31(29,30)24-14-6-5-7-25(11-14)16-10-13(18(27)28)9-15(23-19(20)21)17(16)22-12(2)26/h10,14-17,24H,3-9,11H2,1-2H3,(H,22,26)(H,27,28)(H4,20,21,23)/t14-,15-,16+,17+/m0/s1 |
| InChIKey | ZACZGIRGPUJNTP-MWDXBVQZSA-N |
| XLogP | -0.90 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|