C16H29N5O3 — CID 10290979
(3R,4S,5S)-4-acetamido-5-(diaminomethylideneamino)-3-(hexan-3-ylamino)cyclohexene-1-carboxylic acid (PubChem CID 10290979) has the molecular formula C16H29N5O3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3R,4S,5S)-4-acetamido-5-(diaminomethylideneamino)-3-(hexan-3-ylamino)cyclohexene-1-carboxylic acid.
| Compound Name | (3R,4S,5S)-4-acetamido-5-(diaminomethylideneamino)-3-(hexan-3-ylamino)cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 10290979 |
| Molecular Formula | C16H29N5O3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (3R,4S,5S)-4-acetamido-5-(diaminomethylideneamino)-3-(hexan-3-ylamino)cyclohexene-1-carboxylic acid |
| SMILES | CCCC(CC)N[C@@H]1C=C(C(=O)O)C[C@H](N=C(N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C16H29N5O3/c1-4-6-11(5-2)20-12-7-10(15(23)24)8-13(21-16(17)18)14(12)19-9(3)22/h7,11-14,20H,4-6,8H2,1-3H3,(H,19,22)(H,23,24)(H4,17,18,21)/t11?,12-,13+,14+/m1/s1 |
| InChIKey | HBHSVHNGDPQACD-LHBNMAMBSA-N |
| XLogP | 0.08 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|