C14H25BF3KN4O2 — CID 155521870
potassium [(3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-pentan-3-yloxycyclohexen-1-yl]-trifluoroboranuide (PubChem CID 155521870) has the molecular formula C14H25BF3KN4O2 and a molecular weight of 388.28 g/mol. Its IUPAC name is potassium [(3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-pentan-3-yloxycyclohexen-1-yl]-trifluoroboranuide.
| Compound Name | potassium [(3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-pentan-3-yloxycyclohexen-1-yl]-trifluoroboranuide |
|---|---|
| PubChem CID | 155521870 |
| Molecular Formula | C14H25BF3KN4O2 |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | potassium [(3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-pentan-3-yloxycyclohexen-1-yl]-trifluoroboranuide |
| SMILES | CCC(CC)O[C@@H]1C=C([B-](F)(F)F)C[C@H](N=C(N)N)[C@H]1NC(C)=O.[K+] |
| InChI | InChI=1S/C14H25BF3N4O2.K/c1-4-10(5-2)24-12-7-9(15(16,17)18)6-11(22-14(19)20)13(12)21-8(3)23;/h7,10-13H,4-6H2,1-3H3,(H,21,23)(H4,19,20,22);/q-1;+1/t11-,12+,13+;/m0./s1 |
| InChIKey | XCIXZXXBKMZLEK-LUHWTZLKSA-N |
| XLogP | -1.57 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|