C18H26F2N4O4 — CID 140621089
prop-2-ynyl (3R,4R,5S)-5-(diaminomethylideneamino)-4-[(2,2-difluoroacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 140621089) has the molecular formula C18H26F2N4O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is prop-2-ynyl (3R,4R,5S)-5-(diaminomethylideneamino)-4-[(2,2-difluoroacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | prop-2-ynyl (3R,4R,5S)-5-(diaminomethylideneamino)-4-[(2,2-difluoroacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 140621089 |
| Molecular Formula | C18H26F2N4O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | prop-2-ynyl (3R,4R,5S)-5-(diaminomethylideneamino)-4-[(2,2-difluoroacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | C#CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(=O)C(F)F)[C@@H](N=C(N)N)C1 |
| InChI | InChI=1S/C18H26F2N4O4/c1-4-7-27-17(26)10-8-12(23-18(21)22)14(24-16(25)15(19)20)13(9-10)28-11(5-2)6-3/h1,9,11-15H,5-8H2,2-3H3,(H,24,25)(H4,21,22,23)/t12-,13+,14+/m0/s1 |
| InChIKey | KWAZMYZGJAVAGE-BFHYXJOUSA-N |
| XLogP | 0.46 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|