C19H32N6O5 — CID 72721959
(3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3S)-3-(ethylcarbamoyloxymethyl)piperidin-1-yl]cyclohexene-1-carboxylic acid (PubChem CID 72721959) has the molecular formula C19H32N6O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3S)-3-(ethylcarbamoyloxymethyl)piperidin-1-yl]cyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3S)-3-(ethylcarbamoyloxymethyl)piperidin-1-yl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 72721959 |
| Molecular Formula | C19H32N6O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3S)-3-(ethylcarbamoyloxymethyl)piperidin-1-yl]cyclohexene-1-carboxylic acid |
| SMILES | CCNC(=O)OC[C@H]1CCCN([C@@H]2C=C(C(=O)O)C[C@H](N=C(N)N)[C@H]2NC(C)=O)C1 |
| InChI | InChI=1S/C19H32N6O5/c1-3-22-19(29)30-10-12-5-4-6-25(9-12)15-8-13(17(27)28)7-14(24-18(20)21)16(15)23-11(2)26/h8,12,14-16H,3-7,9-10H2,1-2H3,(H,22,29)(H,23,26)(H,27,28)(H4,20,21,24)/t12-,14-,15+,16+/m0/s1 |
| InChIKey | QCNFQASAJIDIOZ-ARLBYUKCSA-N |
| XLogP | -0.63 |
| TPSA | 172.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|