C19H28F3N3O5 — CID 175091572
(2,2,2-trifluoroacetyl) (3R,4R,5S)-4-acetamido-5-amino-3-[(3S)-3-(ethoxymethyl)piperidin-1-yl]cyclohexene-1-carboxylate (PubChem CID 175091572) has the molecular formula C19H28F3N3O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (3R,4R,5S)-4-acetamido-5-amino-3-[(3S)-3-(ethoxymethyl)piperidin-1-yl]cyclohexene-1-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (3R,4R,5S)-4-acetamido-5-amino-3-[(3S)-3-(ethoxymethyl)piperidin-1-yl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 175091572 |
| Molecular Formula | C19H28F3N3O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (3R,4R,5S)-4-acetamido-5-amino-3-[(3S)-3-(ethoxymethyl)piperidin-1-yl]cyclohexene-1-carboxylate |
| SMILES | CCOC[C@H]1CCCN([C@@H]2C=C(C(=O)OC(=O)C(F)(F)F)C[C@H](N)[C@H]2NC(C)=O)C1 |
| InChI | InChI=1S/C19H28F3N3O5/c1-3-29-10-12-5-4-6-25(9-12)15-8-13(7-14(23)16(15)24-11(2)26)17(27)30-18(28)19(20,21)22/h8,12,14-16H,3-7,9-10,23H2,1-2H3,(H,24,26)/t12-,14-,15+,16+/m0/s1 |
| InChIKey | ILFYTDNUXVHDBH-ARLBYUKCSA-N |
| XLogP | 0.90 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|