C18H32N6O5S — CID 72720754
(3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3S)-3-(propan-2-ylsulfonylamino)piperidin-1-yl]cyclohexene-1-carboxylic acid (PubChem CID 72720754) has the molecular formula C18H32N6O5S and a molecular weight of 444.56 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3S)-3-(propan-2-ylsulfonylamino)piperidin-1-yl]cyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3S)-3-(propan-2-ylsulfonylamino)piperidin-1-yl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 72720754 |
| Molecular Formula | C18H32N6O5S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-(diaminomethylideneamino)-3-[(3S)-3-(propan-2-ylsulfonylamino)piperidin-1-yl]cyclohexene-1-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1[C@@H](N=C(N)N)CC(C(=O)O)=C[C@H]1N1CCC[C@H](NS(=O)(=O)C(C)C)C1 |
| InChI | InChI=1S/C18H32N6O5S/c1-10(2)30(28,29)23-13-5-4-6-24(9-13)15-8-12(17(26)27)7-14(22-18(19)20)16(15)21-11(3)25/h8,10,13-16,23H,4-7,9H2,1-3H3,(H,21,25)(H,26,27)(H4,19,20,22)/t13-,14-,15+,16+/m0/s1 |
| InChIKey | GCBYXKNJQPCVNJ-CAOSSQGBSA-N |
| XLogP | -1.29 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|