C21H36N4O8 — CID 44574205
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-3-(2-ethylhexanoyloxy)-2-hydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 44574205) has the molecular formula C21H36N4O8 and a molecular weight of 472.54 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-3-(2-ethylhexanoyloxy)-2-hydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-3-(2-ethylhexanoyloxy)-2-hydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 44574205 |
| Molecular Formula | C21H36N4O8 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-3-(2-ethylhexanoyloxy)-2-hydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCCC(CC)C(=O)OC[C@@H](O)[C@@H](OC)[C@@H]1OC(C(=O)O)=C[C@H](N=C(N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C21H36N4O8/c1-5-7-8-12(6-2)20(30)32-10-14(27)17(31-4)18-16(24-11(3)26)13(25-21(22)23)9-15(33-18)19(28)29/h9,12-14,16-18,27H,5-8,10H2,1-4H3,(H,24,26)(H,28,29)(H4,22,23,25)/t12?,13-,14+,16+,17+,18+/m0/s1 |
| InChIKey | VHYDVUKKIOVBFZ-DNMIRGEBSA-N |
| XLogP | -0.36 |
| TPSA | 195.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|