About 1-amino-5-hydroxypentan-2-one;molecular hydrogen
1-amino-5-hydroxypentan-2-one;molecular hydrogen (PubChem CID 158297094) has the molecular formula C5H13NO2
and a molecular weight of 119.16 g/mol. Its IUPAC name is 1-amino-5-hydroxypentan-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 1-amino-5-hydroxypentan-2-one;molecular hydrogen |
| PubChem CID | 158297094 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | 1-amino-5-hydroxypentan-2-one;molecular hydrogen |
| SMILES | NCC(=O)CCCO.[H][H] |
| InChI | InChI=1S/C5H11NO2.H2/c6-4-5(8)2-1-3-7;/h7H,1-4,6H2;1H |
| InChIKey | GMAVPMDVFAUTIK-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-5-hydroxypentan-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-5-hydroxypentan-2-one;molecular hydrogen?
The IUPAC name of 1-amino-5-hydroxypentan-2-one;molecular hydrogen (CID 158297094) is 1-amino-5-hydroxypentan-2-one;molecular hydrogen.
What is the SMILES notation for 1-amino-5-hydroxypentan-2-one;molecular hydrogen?
The canonical SMILES for 1-amino-5-hydroxypentan-2-one;molecular hydrogen is NCC(=O)CCCO.[H][H].
What is the InChIKey of 1-amino-5-hydroxypentan-2-one;molecular hydrogen?
The InChIKey is GMAVPMDVFAUTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.H2/c6-4-5(8)2-1-3-7;/h7H,1-4,6H2;1H.
What are the key properties of 1-amino-5-hydroxypentan-2-one;molecular hydrogen?
1-amino-5-hydroxypentan-2-one;molecular hydrogen has a molecular weight of 119.16 g/mol, XLogP of -0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-5-hydroxypentan-2-one;molecular hydrogen is sourced from PubChem (CID 158297094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).