About 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid
5-amino-4-oxopentanoic acid;2-hydroxyacetic acid (PubChem CID 50943305) has the molecular formula C7H13NO6
and a molecular weight of 207.18 g/mol. Its IUPAC name is 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid.
Molecular Properties
| Compound Name | 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid |
| PubChem CID | 50943305 |
| Molecular Formula | C7H13NO6 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid |
| SMILES | NCC(=O)CCC(=O)O.O=C(O)CO |
| InChI | InChI=1S/C5H9NO3.C2H4O3/c6-3-4(7)1-2-5(8)9;3-1-2(4)5/h1-3,6H2,(H,8,9);3H,1H2,(H,4,5) |
| InChIKey | PQBLJKSZDRPSHR-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid?
The IUPAC name of 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid (CID 50943305) is 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid.
What is the SMILES notation for 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid?
The canonical SMILES for 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid is NCC(=O)CCC(=O)O.O=C(O)CO.
What is the InChIKey of 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid?
The InChIKey is PQBLJKSZDRPSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3.C2H4O3/c6-3-4(7)1-2-5(8)9;3-1-2(4)5/h1-3,6H2,(H,8,9);3H,1H2,(H,4,5).
What are the key properties of 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid?
5-amino-4-oxopentanoic acid;2-hydroxyacetic acid has a molecular weight of 207.18 g/mol, XLogP of -1.56, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-oxopentanoic acid;2-hydroxyacetic acid is sourced from PubChem (CID 50943305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).