About 4-hydroxybutanethioic S-acid
4-hydroxybutanethioic S-acid (PubChem CID 21407745) has the molecular formula C4H8O2S
and a molecular weight of 120.17 g/mol. Its IUPAC name is 4-hydroxybutanethioic S-acid.
Molecular Properties
| Compound Name | 4-hydroxybutanethioic S-acid |
| PubChem CID | 21407745 |
| Molecular Formula | C4H8O2S |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | 4-hydroxybutanethioic S-acid |
| SMILES | O=C(S)CCCO |
| InChI | InChI=1S/C4H8O2S/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7) |
| InChIKey | UMFPOZIYWISJLX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutanethioic S-acid?
The IUPAC name of 4-hydroxybutanethioic S-acid (CID 21407745) is 4-hydroxybutanethioic S-acid.
What is the SMILES notation for 4-hydroxybutanethioic S-acid?
The canonical SMILES for 4-hydroxybutanethioic S-acid is O=C(S)CCCO.
What is the InChIKey of 4-hydroxybutanethioic S-acid?
The InChIKey is UMFPOZIYWISJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2S/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7).
What are the key properties of 4-hydroxybutanethioic S-acid?
4-hydroxybutanethioic S-acid has a molecular weight of 120.17 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutanethioic S-acid is sourced from PubChem (CID 21407745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).