About 3-hydroxypropanethioic S-acid;hydrate
3-hydroxypropanethioic S-acid;hydrate (PubChem CID 174291288) has the molecular formula C3H8O3S
and a molecular weight of 124.16 g/mol. Its IUPAC name is 3-hydroxypropanethioic S-acid;hydrate.
Molecular Properties
| Compound Name | 3-hydroxypropanethioic S-acid;hydrate |
| PubChem CID | 174291288 |
| Molecular Formula | C3H8O3S |
| Molecular Weight | 124.16 g/mol |
| Exact Mass | 124.02 |
| IUPAC Name | 3-hydroxypropanethioic S-acid;hydrate |
| SMILES | O.O=C(S)CCO |
| InChI | InChI=1S/C3H6O2S.H2O/c4-2-1-3(5)6;/h4H,1-2H2,(H,5,6);1H2 |
| InChIKey | YRLGHEFCTTYITA-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.16 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropanethioic S-acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropanethioic S-acid;hydrate?
The IUPAC name of 3-hydroxypropanethioic S-acid;hydrate (CID 174291288) is 3-hydroxypropanethioic S-acid;hydrate.
What is the SMILES notation for 3-hydroxypropanethioic S-acid;hydrate?
The canonical SMILES for 3-hydroxypropanethioic S-acid;hydrate is O.O=C(S)CCO.
What is the InChIKey of 3-hydroxypropanethioic S-acid;hydrate?
The InChIKey is YRLGHEFCTTYITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S.H2O/c4-2-1-3(5)6;/h4H,1-2H2,(H,5,6);1H2.
What are the key properties of 3-hydroxypropanethioic S-acid;hydrate?
3-hydroxypropanethioic S-acid;hydrate has a molecular weight of 124.16 g/mol, XLogP of -1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropanethioic S-acid;hydrate is sourced from PubChem (CID 174291288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).