About 5-hydroxy-2-oxopentanoic acid
5-hydroxy-2-oxopentanoic acid (PubChem CID 23572080) has the molecular formula C5H8O4
and a molecular weight of 132.12 g/mol. Its IUPAC name is 5-hydroxy-2-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-hydroxy-2-oxopentanoic acid |
| PubChem CID | 23572080 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 5-hydroxy-2-oxopentanoic acid |
| SMILES | O=C(O)C(=O)CCCO |
| InChI | InChI=1S/C5H8O4/c6-3-1-2-4(7)5(8)9/h6H,1-3H2,(H,8,9) |
| InChIKey | MMTYWJNSFWVPPS-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-oxopentanoic acid?
The IUPAC name of 5-hydroxy-2-oxopentanoic acid (CID 23572080) is 5-hydroxy-2-oxopentanoic acid.
What is the SMILES notation for 5-hydroxy-2-oxopentanoic acid?
The canonical SMILES for 5-hydroxy-2-oxopentanoic acid is O=C(O)C(=O)CCCO.
What is the InChIKey of 5-hydroxy-2-oxopentanoic acid?
The InChIKey is MMTYWJNSFWVPPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4/c6-3-1-2-4(7)5(8)9/h6H,1-3H2,(H,8,9).
What are the key properties of 5-hydroxy-2-oxopentanoic acid?
5-hydroxy-2-oxopentanoic acid has a molecular weight of 132.12 g/mol, XLogP of -0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-oxopentanoic acid is sourced from PubChem (CID 23572080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).