About 8-amino-2-oxooctanoic acid
8-amino-2-oxooctanoic acid (PubChem CID 87379118) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 8-amino-2-oxooctanoic acid.
Molecular Properties
| Compound Name | 8-amino-2-oxooctanoic acid |
| PubChem CID | 87379118 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 8-amino-2-oxooctanoic acid |
| SMILES | NCCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c9-6-4-2-1-3-5-7(10)8(11)12/h1-6,9H2,(H,11,12) |
| InChIKey | SUYRJGXWFYPEOO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-2-oxooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-2-oxooctanoic acid?
The IUPAC name of 8-amino-2-oxooctanoic acid (CID 87379118) is 8-amino-2-oxooctanoic acid.
What is the SMILES notation for 8-amino-2-oxooctanoic acid?
The canonical SMILES for 8-amino-2-oxooctanoic acid is NCCCCCCC(=O)C(=O)O.
What is the InChIKey of 8-amino-2-oxooctanoic acid?
The InChIKey is SUYRJGXWFYPEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c9-6-4-2-1-3-5-7(10)8(11)12/h1-6,9H2,(H,11,12).
What are the key properties of 8-amino-2-oxooctanoic acid?
8-amino-2-oxooctanoic acid has a molecular weight of 173.21 g/mol, XLogP of 0.55, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-2-oxooctanoic acid is sourced from PubChem (CID 87379118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).