C15H13F3NO2- — CID 158297554
benzhydrylazanide;2,2,2-trifluoroacetic acid (PubChem CID 158297554) has the molecular formula C15H13F3NO2- and a molecular weight of 296.27 g/mol. Its IUPAC name is benzhydrylazanide;2,2,2-trifluoroacetic acid.
| Compound Name | benzhydrylazanide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158297554 |
| Molecular Formula | C15H13F3NO2- |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | benzhydrylazanide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[NH-]C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12N.C2HF3O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-2(4,5)1(6)7/h1-10,13-14H;(H,6,7)/q-1; |
| InChIKey | GMCCBOGWWCVCMG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |