C12H14FN3O3 — CID 158298338
7-[(1S,2S,3R,4R)-2-fluoro-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 158298338) has the molecular formula C12H14FN3O3 and a molecular weight of 267.26 g/mol. Its IUPAC name is 7-[(1S,2S,3R,4R)-2-fluoro-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[(1S,2S,3R,4R)-2-fluoro-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 158298338 |
| Molecular Formula | C12H14FN3O3 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 7-[(1S,2S,3R,4R)-2-fluoro-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c([C@@H]3C[C@H](CO)[C@@H](O)[C@H]3F)c[nH]c12 |
| InChI | InChI=1S/C12H14FN3O3/c13-8-6(1-5(3-17)11(8)18)7-2-14-10-9(7)15-4-16-12(10)19/h2,4-6,8,11,14,17-18H,1,3H2,(H,15,16,19)/t5-,6+,8+,11-/m1/s1 |
| InChIKey | RQYQNSJOGXOIBR-CYQNLZQDSA-N |
| XLogP | 0.05 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |