C17H25N5O4 — CID 158456799
[(1S,2R,3R,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2-hydroxy-3-(hydroxymethyl)cyclopentyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 158456799) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is [(1S,2R,3R,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2-hydroxy-3-(hydroxymethyl)cyclopentyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(1S,2R,3R,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2-hydroxy-3-(hydroxymethyl)cyclopentyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 158456799 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [(1S,2R,3R,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2-hydroxy-3-(hydroxymethyl)cyclopentyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)O[C@@H]1[C@H](O)[C@@H](CO)C[C@H]1c1c[nH]c2c(N)ncnc12 |
| InChI | InChI=1S/C17H25N5O4/c1-7(2)11(18)17(25)26-15-9(3-8(5-23)14(15)24)10-4-20-13-12(10)21-6-22-16(13)19/h4,6-9,11,14-15,20,23-24H,3,5,18H2,1-2H3,(H2,19,21,22)/t8-,9+,11+,14-,15+/m1/s1 |
| InChIKey | JCHOSSZQFVOFEU-CDFCKNRYSA-N |
| XLogP | -0.11 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |