About potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide
potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide (PubChem CID 158306667) has the molecular formula C11H12KNO3S
and a molecular weight of 277.39 g/mol. Its IUPAC name is potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide.
Molecular Properties
| Compound Name | potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide |
| PubChem CID | 158306667 |
| Molecular Formula | C11H12KNO3S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide |
| SMILES | CC1=Nc2cc[c-]cc2C1(C)C.O=S(=O)=O.[K+] |
| InChI | InChI=1S/C11H12N.K.O3S/c1-8-11(2,3)9-6-4-5-7-10(9)12-8;;1-4(2)3/h5-7H,1-3H3;;/q-1;+1; |
| InChIKey | DNCWRCRVINVBJR-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide?
The IUPAC name of potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide (CID 158306667) is potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide.
What is the SMILES notation for potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide?
The canonical SMILES for potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide is CC1=Nc2cc[c-]cc2C1(C)C.O=S(=O)=O.[K+].
What is the InChIKey of potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide?
The InChIKey is DNCWRCRVINVBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N.K.O3S/c1-8-11(2,3)9-6-4-5-7-10(9)12-8;;1-4(2)3/h5-7H,1-3H3;;/q-1;+1;.
What are the key properties of potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide?
potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide has a molecular weight of 277.39 g/mol, XLogP of -1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;sulfur trioxide;2,3,3-trimethyl-5H-indol-5-ide is sourced from PubChem (CID 158306667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).