C12H15KN+ — CID 167423280
potassium 1,2,3,3-tetramethyl-5H-indol-1-ium-5-ide (PubChem CID 167423280) has the molecular formula C12H15KN+ and a molecular weight of 212.36 g/mol. Its IUPAC name is potassium 1,2,3,3-tetramethyl-5H-indol-1-ium-5-ide.
| Compound Name | potassium 1,2,3,3-tetramethyl-5H-indol-1-ium-5-ide |
|---|---|
| PubChem CID | 167423280 |
| Molecular Formula | C12H15KN+ |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | potassium 1,2,3,3-tetramethyl-5H-indol-1-ium-5-ide |
| SMILES | CC1=[N+](C)c2cc[c-]cc2C1(C)C.[K+] |
| InChI | InChI=1S/C12H15N.K/c1-9-12(2,3)10-7-5-6-8-11(10)13(9)4;/h6-8H,1-4H3;/q;+1 |
| InChIKey | PLPXNRNPXZDUIG-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|