C13H17KN+ — CID 140660238
potassium 1-ethyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide (PubChem CID 140660238) has the molecular formula C13H17KN+ and a molecular weight of 226.38 g/mol. Its IUPAC name is potassium 1-ethyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide.
| Compound Name | potassium 1-ethyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide |
|---|---|
| PubChem CID | 140660238 |
| Molecular Formula | C13H17KN+ |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | potassium 1-ethyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide |
| SMILES | CC[N+]1=C(C)C(C)(C)c2c[c-]ccc21.[K+] |
| InChI | InChI=1S/C13H17N.K/c1-5-14-10(2)13(3,4)11-8-6-7-9-12(11)14;/h7-9H,5H2,1-4H3;/q;+1 |
| InChIKey | HUCXKJFDOXGXOO-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|