C14H18FNNa+ — CID 58489082
sodium 7-(18F)fluoro-2,3,3-trimethyl-1-propyl-5H-indol-1-ium-5-ide (PubChem CID 58489082) has the molecular formula C14H18FNNa+ and a molecular weight of 241.30 g/mol. Its IUPAC name is sodium 7-(18F)fluoro-2,3,3-trimethyl-1-propyl-5H-indol-1-ium-5-ide.
| Compound Name | sodium 7-(18F)fluoro-2,3,3-trimethyl-1-propyl-5H-indol-1-ium-5-ide |
|---|---|
| PubChem CID | 58489082 |
| Molecular Formula | C14H18FNNa+ |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | sodium 7-(18F)fluoro-2,3,3-trimethyl-1-propyl-5H-indol-1-ium-5-ide |
| SMILES | CCC[N+]1=C(C)C(C)(C)c2c[c-]cc([18F])c21.[Na+] |
| InChI | InChI=1S/C14H18FN.Na/c1-5-9-16-10(2)14(3,4)11-7-6-8-12(15)13(11)16;/h7-8H,5,9H2,1-4H3;/q;+1/i15-1; |
| InChIKey | QMIVPGMROFPBJE-MWEVCRGTSA-N |
| XLogP | 0.44 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|