C14H18INNa+ — CID 58489095
sodium 6-(131I)iodo-2,3,3-trimethyl-1-propyl-5H-indol-1-ium-5-ide (PubChem CID 58489095) has the molecular formula C14H18INNa+ and a molecular weight of 354.20 g/mol. Its IUPAC name is sodium 6-(131I)iodo-2,3,3-trimethyl-1-propyl-5H-indol-1-ium-5-ide.
| Compound Name | sodium 6-(131I)iodo-2,3,3-trimethyl-1-propyl-5H-indol-1-ium-5-ide |
|---|---|
| PubChem CID | 58489095 |
| Molecular Formula | C14H18INNa+ |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | sodium 6-(131I)iodo-2,3,3-trimethyl-1-propyl-5H-indol-1-ium-5-ide |
| SMILES | CCC[N+]1=C(C)C(C)(C)c2c[c-]c([131I])cc21.[Na+] |
| InChI | InChI=1S/C14H18IN.Na/c1-5-8-16-10(2)14(3,4)12-7-6-11(15)9-13(12)16;/h7,9H,5,8H2,1-4H3;/q;+1/i15+4; |
| InChIKey | HMRUOXCTXSSOFD-TZGNFBSBSA-N |
| XLogP | 0.90 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|