C18H15N7O3 — CID 158307453
5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide;5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (PubChem CID 158307453) has the molecular formula C18H15N7O3 and a molecular weight of 377.36 g/mol. Its IUPAC name is 5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide;5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid.
| Compound Name | 5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide;5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 158307453 |
| Molecular Formula | C18H15N7O3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide;5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid |
| SMILES | Cc1cnc2[nH]cc(C(=O)N=[N+]=[N-])c2c1.Cc1cnc2[nH]cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C9H7N5O.C9H8N2O2/c1-5-2-6-7(9(15)13-14-10)4-12-8(6)11-3-5;1-5-2-6-7(9(12)13)4-11-8(6)10-3-5/h2-4H,1H3,(H,11,12);2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | GNGIJHMUYPNJIG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|