C30H28BCl5N2O6 — CID 158310700
phenylboronic acid;propan-2-yl 4,5-dichloro-6-phenylpyridine-2-carboxylate;propan-2-yl 4,5,6-trichloropyridine-2-carboxylate (PubChem CID 158310700) has the molecular formula C30H28BCl5N2O6 and a molecular weight of 700.64 g/mol. Its IUPAC name is phenylboronic acid;propan-2-yl 4,5-dichloro-6-phenylpyridine-2-carboxylate;propan-2-yl 4,5,6-trichloropyridine-2-carboxylate.
| Compound Name | phenylboronic acid;propan-2-yl 4,5-dichloro-6-phenylpyridine-2-carboxylate;propan-2-yl 4,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 158310700 |
| Molecular Formula | C30H28BCl5N2O6 |
| Molecular Weight | 700.64 g/mol |
| Exact Mass | 698.05 |
| IUPAC Name | phenylboronic acid;propan-2-yl 4,5-dichloro-6-phenylpyridine-2-carboxylate;propan-2-yl 4,5,6-trichloropyridine-2-carboxylate |
| SMILES | CC(C)OC(=O)c1cc(Cl)c(Cl)c(-c2ccccc2)n1.CC(C)OC(=O)c1cc(Cl)c(Cl)c(Cl)n1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C15H13Cl2NO2.C9H8Cl3NO2.C6H7BO2/c1-9(2)20-15(19)12-8-11(16)13(17)14(18-12)10-6-4-3-5-7-10;1-4(2)15-9(14)6-3-5(10)7(11)8(12)13-6;8-7(9)6-4-2-1-3-5-6/h3-9H,1-2H3;3-4H,1-2H3;1-5,8-9H |
| InChIKey | GNQKWVBDPNMTOQ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.64 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|