C39H41F2N3O6 — CID 158315753
4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4,5-bis(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]phenyl]butan-1-one (PubChem CID 158315753) has the molecular formula C39H41F2N3O6 and a molecular weight of 685.77 g/mol. Its IUPAC name is 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4,5-bis(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]phenyl]butan-1-one.
| Compound Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4,5-bis(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 158315753 |
| Molecular Formula | C39H41F2N3O6 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.30 |
| IUPAC Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4,5-bis(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]phenyl]butan-1-one |
| SMILES | COc1cc(-c2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)n2Cc2ccc(C(=O)CCCOCCOCCN)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C39H41F2N3O6/c1-46-34-23-30(24-35(47-2)38(34)48-3)39-43-36(28-10-14-31(40)15-11-28)37(29-12-16-32(41)17-13-29)44(39)25-26-6-8-27(9-7-26)33(45)5-4-19-49-21-22-50-20-18-42/h6-17,23-24H,4-5,18-22,25,42H2,1-3H3 |
| InChIKey | NGPIRZMNIBVIKR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|