C11H11IN2O — CID 158316554
1-(3-iodoimidazo[1,2-a]pyridin-7-yl)butan-1-one (PubChem CID 158316554) has the molecular formula C11H11IN2O and a molecular weight of 314.13 g/mol. Its IUPAC name is 1-(3-iodoimidazo[1,2-a]pyridin-7-yl)butan-1-one.
| Compound Name | 1-(3-iodoimidazo[1,2-a]pyridin-7-yl)butan-1-one |
|---|---|
| PubChem CID | 158316554 |
| Molecular Formula | C11H11IN2O |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 1-(3-iodoimidazo[1,2-a]pyridin-7-yl)butan-1-one |
| SMILES | CCCC(=O)c1ccn2c(I)cnc2c1 |
| InChI | InChI=1S/C11H11IN2O/c1-2-3-9(15)8-4-5-14-10(12)7-13-11(14)6-8/h4-7H,2-3H2,1H3 |
| InChIKey | UEUCXAYWJXGKCK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|