C20H15FN2O2 — CID 58574223
3-butanoyl-8-[2-(3-fluorophenyl)ethynyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 58574223) has the molecular formula C20H15FN2O2 and a molecular weight of 334.35 g/mol. Its IUPAC name is 3-butanoyl-8-[2-(3-fluorophenyl)ethynyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-butanoyl-8-[2-(3-fluorophenyl)ethynyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 58574223 |
| Molecular Formula | C20H15FN2O2 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-butanoyl-8-[2-(3-fluorophenyl)ethynyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCC(=O)c1cnc2cc(C#Cc3cccc(F)c3)ccn2c1=O |
| InChI | InChI=1S/C20H15FN2O2/c1-2-4-18(24)17-13-22-19-12-15(9-10-23(19)20(17)25)8-7-14-5-3-6-16(21)11-14/h3,5-6,9-13H,2,4H2,1H3 |
| InChIKey | PCNTUNNWCIVYCF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|