C12H20N2O8 — CID 158317116
2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(2-oxopropyl)amino]acetic acid (PubChem CID 158317116) has the molecular formula C12H20N2O8 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(2-oxopropyl)amino]acetic acid.
| Compound Name | 2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(2-oxopropyl)amino]acetic acid |
|---|---|
| PubChem CID | 158317116 |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(2-oxopropyl)amino]acetic acid |
| SMILES | CC(=O)CN(CC(=O)O)CC(O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C12H20N2O8/c1-8(15)2-13(5-10(17)18)3-9(16)4-14(6-11(19)20)7-12(21)22/h9,16H,2-7H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | FTTBRPQBFIMKSR-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |